2-[(1-benzyl-5-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-[2-(4-fluorophenyl)ethyl]acetamide
ethyl 1,3-dimethyl-1H-pyrazole-5-carboxylate
CAS: 5744-40-1;933728-77-9
Molecular Formula: C8H12N2O2
2-[(1-benzyl-5-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-[2-(4-fluorophenyl)ethyl]acetamide - Names and Identifiers
| Name | ethyl 1,3-dimethyl-1H-pyrazole-5-carboxylate |
| Synonyms | AKOS PAO-0382 RARECHEM AL BI 1315 Ethyl 1,3-dimethylpyrazole-5-carboxylate ETHYL 1,3-DIMETHYLPYRAZOLE-5-CARBOXYLATE ETHYL 1,3-DIMETHYL-1H-PYRAZOLE-5-CARBOXYLATE ethyl 1,3-dimethyl-1H-pyrazole-5-carboxylate 1,2,4,5,6,7-hexahydropyrazolo[4,5-c]pyridin-3-one 1,3-DIMETHYL-1H-PYRAZOLE-5-CARBOXYLIC ACID ETHYL ESTER 2-[(1-benzyl-5-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-[2-(4-fluorophenyl)ethyl]acetamide |
| CAS | 5744-40-1 933728-77-9 |
| InChI | InChI=1/C6H9N3O/c10-6-4-3-7-2-1-5(4)8-9-6/h7H,1-3H2,(H2,8,9,10) |
| InChIKey | ZYSGPOXVDOROJU-UHFFFAOYSA-N |
2-[(1-benzyl-5-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-[2-(4-fluorophenyl)ethyl]acetamide - Physico-chemical Properties
| Molecular Formula | C8H12N2O2 |
| Molar Mass | 168.19 |
| Density | 1.12±0.1 g/cm3(Predicted) |
| Melting Point | 40-42 °C |
| Boling Point | 80°C 1mm |
| Appearance | clear liquid |
| Color | Light yellow to Yellow to Orange |
| pKa | 1.03±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.4790 to 1.4830 |
2-[(1-benzyl-5-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-[2-(4-fluorophenyl)ethyl]acetamide - Risk and Safety
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S23 - Do not breathe vapour. |
| HS Code | 29331990 |
| Hazard Class | IRRITANT |
2-[(1-benzyl-5-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-[2-(4-fluorophenyl)ethyl]acetamide - Introduction
Ethyl 1, is an organic compound with the chemical formula C9H14N2O2. Its properties are as follows:
1. appearance: ethyl 1, is a colorless to light yellow liquid.
2. Solubility: It can be dissolved in common organic solvents, such as ethanol, acetone and chloroform.
3. melting point and boiling point: ethyl 1, the melting point of ethyl 1 is about -25 ℃, and the boiling point is about 207 ℃.
4. odor: this compound usually has a special smell.
ethyl 1, has certain application in the field of medicine and pesticide.
1. Medical use: It can be used as an intermediate for the synthesis of certain drugs, such as antitumor drugs.
2. Pesticide use: It can also be used to synthesize certain insecticides and fungicides.
The common method for preparing ethyl 1 is to react pyrazolone with acetoacetate and obtain the product after acid catalysis.
When using ethyl 1, the following safety information needs to be paid attention:
1. Avoid contact with skin and eyes: This compound can be absorbed through the skin and eyes, and direct contact should be avoided.
2. Use protective equipment: When handling the compound, wear protective equipment such as chemical protective gloves, goggles and protective clothing.
3. Avoid inhalation: Operate in a well-ventilated place to avoid inhaling the vapor of the compound.
4. storage precautions: it should be stored in a cool, dry and well ventilated place, away from fire and oxidant.
1. appearance: ethyl 1, is a colorless to light yellow liquid.
2. Solubility: It can be dissolved in common organic solvents, such as ethanol, acetone and chloroform.
3. melting point and boiling point: ethyl 1, the melting point of ethyl 1 is about -25 ℃, and the boiling point is about 207 ℃.
4. odor: this compound usually has a special smell.
ethyl 1, has certain application in the field of medicine and pesticide.
1. Medical use: It can be used as an intermediate for the synthesis of certain drugs, such as antitumor drugs.
2. Pesticide use: It can also be used to synthesize certain insecticides and fungicides.
The common method for preparing ethyl 1 is to react pyrazolone with acetoacetate and obtain the product after acid catalysis.
When using ethyl 1, the following safety information needs to be paid attention:
1. Avoid contact with skin and eyes: This compound can be absorbed through the skin and eyes, and direct contact should be avoided.
2. Use protective equipment: When handling the compound, wear protective equipment such as chemical protective gloves, goggles and protective clothing.
3. Avoid inhalation: Operate in a well-ventilated place to avoid inhaling the vapor of the compound.
4. storage precautions: it should be stored in a cool, dry and well ventilated place, away from fire and oxidant.
Last Update：2024-04-09 21:21:28
![2-[(1-benzyl-5-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-[2-(4-fluorophenyl)ethyl]acetamide](http://res.chembk.com/assets/images/structure/933728-77-9.gif)
Supplier List
Product Name: 4,5,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridin-3-ol Visit Supplier Webpage Request for quotation
CAS: 933728-77-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 933728-77-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 4,5,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridin-3-ol Visit Supplier Webpage Request for quotation
CAS: 933728-77-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 933728-77-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History